C21H32O4 — CID 155554913
(1R,3R,4aR,7S,8R,8aR)-7-[(E)-but-2-en-2-yl]-8-(3-hydroxypropanoyl)-3,6,8-trimethyl-2,3,4,4a,7,8a-hexahydro-1H-naphthalene-1-carboxylic acid (PubChem CID 155554913) has the molecular formula C21H32O4 and a molecular weight of 348.48 g/mol. Its IUPAC name is (1R,3R,4aR,7S,8R,8aR)-7-[(E)-but-2-en-2-yl]-8-(3-hydroxypropanoyl)-3,6,8-trimethyl-2,3,4,4a,7,8a-hexahydro-1H-naphthalene-1-carboxylic acid.
| Compound Name | (1R,3R,4aR,7S,8R,8aR)-7-[(E)-but-2-en-2-yl]-8-(3-hydroxypropanoyl)-3,6,8-trimethyl-2,3,4,4a,7,8a-hexahydro-1H-naphthalene-1-carboxylic acid |
|---|---|
| PubChem CID | 155554913 |
| Molecular Formula | C21H32O4 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.23 |
| IUPAC Name | (1R,3R,4aR,7S,8R,8aR)-7-[(E)-but-2-en-2-yl]-8-(3-hydroxypropanoyl)-3,6,8-trimethyl-2,3,4,4a,7,8a-hexahydro-1H-naphthalene-1-carboxylic acid |
| SMILES | C/C=C(\C)[C@H]1C(C)=C[C@H]2C[C@@H](C)C[C@@H](C(=O)O)[C@@H]2[C@@]1(C)C(=O)CCO |
| InChI | InChI=1S/C21H32O4/c1-6-13(3)18-14(4)11-15-9-12(2)10-16(20(24)25)19(15)21(18,5)17(23)7-8-22/h6,11-12,15-16,18-19,22H,7-10H2,1-5H3,(H,24,25)/b13-6+/t12-,15-,16-,18+,19-,21+/m1/s1 |
| InChIKey | LCAKZDTYAJEGJC-QPYQJHIMSA-N |
| XLogP | 3.85 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|