C23H28FN3O4S — CID 155554971
1-[4-[4-[[(3S)-4,4-dioxo-3-phenyl-1,4,5-oxathiazepan-5-yl]methyl]-3-fluorophenyl]piperazin-1-yl]ethanone (PubChem CID 155554971) has the molecular formula C23H28FN3O4S and a molecular weight of 461.56 g/mol. Its IUPAC name is 1-[4-[4-[[(3S)-4,4-dioxo-3-phenyl-1,4,5-oxathiazepan-5-yl]methyl]-3-fluorophenyl]piperazin-1-yl]ethanone.
| Compound Name | 1-[4-[4-[[(3S)-4,4-dioxo-3-phenyl-1,4,5-oxathiazepan-5-yl]methyl]-3-fluorophenyl]piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 155554971 |
| Molecular Formula | C23H28FN3O4S |
| Molecular Weight | 461.56 g/mol |
| Exact Mass | 461.18 |
| IUPAC Name | 1-[4-[4-[[(3S)-4,4-dioxo-3-phenyl-1,4,5-oxathiazepan-5-yl]methyl]-3-fluorophenyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN(c2ccc(CN3CCOC[C@H](c4ccccc4)S3(=O)=O)c(F)c2)CC1 |
| InChI | InChI=1S/C23H28FN3O4S/c1-18(28)25-9-11-26(12-10-25)21-8-7-20(22(24)15-21)16-27-13-14-31-17-23(32(27,29)30)19-5-3-2-4-6-19/h2-8,15,23H,9-14,16-17H2,1H3/t23-/m1/s1 |
| InChIKey | OFAQRKNBHQPFMM-HSZRJFAPSA-N |
| XLogP | 2.40 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|