C18H27BrN2O6 — CID 155555003
[(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 4-bromo-1H-pyrrole-2-carboxylate (PubChem CID 155555003) has the molecular formula C18H27BrN2O6 and a molecular weight of 447.33 g/mol. Its IUPAC name is [(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 4-bromo-1H-pyrrole-2-carboxylate.
| Compound Name | [(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 4-bromo-1H-pyrrole-2-carboxylate |
|---|---|
| PubChem CID | 155555003 |
| Molecular Formula | C18H27BrN2O6 |
| Molecular Weight | 447.33 g/mol |
| Exact Mass | 446.11 |
| IUPAC Name | [(2R,3S,6S)-6-[(2S,3R,4R,6R)-4-amino-6-hydroxy-2,4-dimethyloxan-3-yl]oxy-2-methyloxan-3-yl] 4-bromo-1H-pyrrole-2-carboxylate |
| SMILES | C[C@@H]1O[C@@H](O)C[C@@](C)(N)[C@H]1O[C@H]1CC[C@H](OC(=O)c2cc(Br)c[nH]2)[C@@H](C)O1 |
| InChI | InChI=1S/C18H27BrN2O6/c1-9-13(26-17(23)12-6-11(19)8-21-12)4-5-15(25-9)27-16-10(2)24-14(22)7-18(16,3)20/h6,8-10,13-16,21-22H,4-5,7,20H2,1-3H3/t9-,10+,13+,14-,15+,16+,18-/m1/s1 |
| InChIKey | DRLYHNKGAYRXPD-GYOGUEERSA-N |
| XLogP | 2.06 |
| TPSA | 116.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.33 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |