C15H24O5 — CID 155555004
(E,4S,5S,6R)-4,5,6-trihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hept-2-enoic acid (PubChem CID 155555004) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is (E,4S,5S,6R)-4,5,6-trihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hept-2-enoic acid.
| Compound Name | (E,4S,5S,6R)-4,5,6-trihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hept-2-enoic acid |
|---|---|
| PubChem CID | 155555004 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | (E,4S,5S,6R)-4,5,6-trihydroxy-2-methyl-6-[(1R)-4-methylcyclohex-3-en-1-yl]hept-2-enoic acid |
| SMILES | CC1=CC[C@H]([C@@](C)(O)[C@@H](O)[C@@H](O)/C=C(\C)C(=O)O)CC1 |
| InChI | InChI=1S/C15H24O5/c1-9-4-6-11(7-5-9)15(3,20)13(17)12(16)8-10(2)14(18)19/h4,8,11-13,16-17,20H,5-7H2,1-3H3,(H,18,19)/b10-8+/t11-,12-,13-,15+/m0/s1 |
| InChIKey | XXNHEUYPKWZRDU-KVXDWFHTSA-N |
| XLogP | 1.24 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|