C31H39NO5 — CID 155555028
N-[2-(3,4-dimethoxyphenyl)ethyl]-4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-amine (PubChem CID 155555028) has the molecular formula C31H39NO5 and a molecular weight of 505.66 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-amine.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-amine |
|---|---|
| PubChem CID | 155555028 |
| Molecular Formula | C31H39NO5 |
| Molecular Weight | 505.66 g/mol |
| Exact Mass | 505.28 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-4,18-dimethoxy-2-oxatricyclo[13.3.1.13,7]icosa-1(18),3,5,7(20),15(19),16-hexaen-10-amine |
| SMILES | COc1ccc(CCNC2CCCCc3ccc(OC)c(c3)Oc3cc(ccc3OC)CC2)cc1OC |
| InChI | InChI=1S/C31H39NO5/c1-33-26-14-12-24(19-29(26)36-4)17-18-32-25-8-6-5-7-22-10-15-27(34-2)30(20-22)37-31-21-23(9-13-25)11-16-28(31)35-3/h10-12,14-16,19-21,25,32H,5-9,13,17-18H2,1-4H3 |
| InChIKey | QZSNYQLWQPAZRL-UHFFFAOYSA-N |
| XLogP | 6.37 |
| TPSA | 58.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.66 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |