C24H26N6O2 — CID 155555076
5-[1-[(4-cyanophenyl)methyl]triazol-4-yl]-2-methyl-N-(2-morpholin-4-ylethyl)benzamide (PubChem CID 155555076) has the molecular formula C24H26N6O2 and a molecular weight of 430.51 g/mol. Its IUPAC name is 5-[1-[(4-cyanophenyl)methyl]triazol-4-yl]-2-methyl-N-(2-morpholin-4-ylethyl)benzamide.
| Compound Name | 5-[1-[(4-cyanophenyl)methyl]triazol-4-yl]-2-methyl-N-(2-morpholin-4-ylethyl)benzamide |
|---|---|
| PubChem CID | 155555076 |
| Molecular Formula | C24H26N6O2 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.21 |
| IUPAC Name | 5-[1-[(4-cyanophenyl)methyl]triazol-4-yl]-2-methyl-N-(2-morpholin-4-ylethyl)benzamide |
| SMILES | Cc1ccc(-c2cn(Cc3ccc(C#N)cc3)nn2)cc1C(=O)NCCN1CCOCC1 |
| InChI | InChI=1S/C24H26N6O2/c1-18-2-7-21(14-22(18)24(31)26-8-9-29-10-12-32-13-11-29)23-17-30(28-27-23)16-20-5-3-19(15-25)4-6-20/h2-7,14,17H,8-13,16H2,1H3,(H,26,31) |
| InChIKey | OKUMLMUOHYXASE-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 96.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |