C33H46O6 — CID 155555107
(1S,9S,10S,11R)-7-benzoyl-11-(3-hydroxy-3-methylbutyl)-10-(4-hydroxy-4-methylpentyl)-4,4,10-trimethyl-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione (PubChem CID 155555107) has the molecular formula C33H46O6 and a molecular weight of 538.73 g/mol. Its IUPAC name is (1S,9S,10S,11R)-7-benzoyl-11-(3-hydroxy-3-methylbutyl)-10-(4-hydroxy-4-methylpentyl)-4,4,10-trimethyl-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione.
| Compound Name | (1S,9S,10S,11R)-7-benzoyl-11-(3-hydroxy-3-methylbutyl)-10-(4-hydroxy-4-methylpentyl)-4,4,10-trimethyl-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione |
|---|---|
| PubChem CID | 155555107 |
| Molecular Formula | C33H46O6 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.33 |
| IUPAC Name | (1S,9S,10S,11R)-7-benzoyl-11-(3-hydroxy-3-methylbutyl)-10-(4-hydroxy-4-methylpentyl)-4,4,10-trimethyl-5-oxatricyclo[7.3.1.01,6]tridec-6-ene-8,13-dione |
| SMILES | CC(C)(O)CCC[C@@]1(C)[C@H](CCC(C)(C)O)C[C@@]23CCC(C)(C)OC2=C(C(=O)c2ccccc2)C(=O)[C@@H]1C3=O |
| InChI | InChI=1S/C33H46O6/c1-29(2,37)15-11-16-32(7)22(14-17-30(3,4)38)20-33-19-18-31(5,6)39-28(33)23(26(35)24(32)27(33)36)25(34)21-12-9-8-10-13-21/h8-10,12-13,22,24,37-38H,11,14-20H2,1-7H3/t22-,24-,32+,33-/m1/s1 |
| InChIKey | FIIKBGSSQPBQGO-XMHFCOLBSA-N |
| XLogP | 5.99 |
| TPSA | 100.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|