C22H18N4O — CID 155555121
[4-[6-(1-methylindol-5-yl)imidazo[1,2-a]pyrazin-3-yl]phenyl]methanol (PubChem CID 155555121) has the molecular formula C22H18N4O and a molecular weight of 354.41 g/mol. Its IUPAC name is [4-[6-(1-methylindol-5-yl)imidazo[1,2-a]pyrazin-3-yl]phenyl]methanol.
| Compound Name | [4-[6-(1-methylindol-5-yl)imidazo[1,2-a]pyrazin-3-yl]phenyl]methanol |
|---|---|
| PubChem CID | 155555121 |
| Molecular Formula | C22H18N4O |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.15 |
| IUPAC Name | [4-[6-(1-methylindol-5-yl)imidazo[1,2-a]pyrazin-3-yl]phenyl]methanol |
| SMILES | Cn1ccc2cc(-c3cn4c(-c5ccc(CO)cc5)cnc4cn3)ccc21 |
| InChI | InChI=1S/C22H18N4O/c1-25-9-8-18-10-17(6-7-20(18)25)19-13-26-21(11-24-22(26)12-23-19)16-4-2-15(14-27)3-5-16/h2-13,27H,14H2,1H3 |
| InChIKey | LKGGELUCFBYIDO-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |