C21H20F3N3O5 — CID 155555306
4-[2-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-(trifluoromethoxy)phenyl]morpholine (PubChem CID 155555306) has the molecular formula C21H20F3N3O5 and a molecular weight of 451.40 g/mol. Its IUPAC name is 4-[2-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-(trifluoromethoxy)phenyl]morpholine.
| Compound Name | 4-[2-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-(trifluoromethoxy)phenyl]morpholine |
|---|---|
| PubChem CID | 155555306 |
| Molecular Formula | C21H20F3N3O5 |
| Molecular Weight | 451.40 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 4-[2-[5-(3,4-dimethoxyphenyl)-1,3,4-oxadiazol-2-yl]-4-(trifluoromethoxy)phenyl]morpholine |
| SMILES | COc1ccc(-c2nnc(-c3cc(OC(F)(F)F)ccc3N3CCOCC3)o2)cc1OC |
| InChI | InChI=1S/C21H20F3N3O5/c1-28-17-6-3-13(11-18(17)29-2)19-25-26-20(31-19)15-12-14(32-21(22,23)24)4-5-16(15)27-7-9-30-10-8-27/h3-6,11-12H,7-10H2,1-2H3 |
| InChIKey | ZZJMPYZXFFRHBS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 79.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.40 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|