About 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine
6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine (PubChem CID 155555328) has the molecular formula C18H14N6
and a molecular weight of 314.35 g/mol. Its IUPAC name is 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine.
Molecular Properties
| Compound Name | 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine |
| PubChem CID | 155555328 |
| Molecular Formula | C18H14N6 |
| Molecular Weight | 314.35 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine |
| SMILES | Nc1ncc2cc(-c3ccccc3-c3cccnc3)c(N)nc2n1 |
| InChI | InChI=1S/C18H14N6/c19-16-15(8-12-10-22-18(20)24-17(12)23-16)14-6-2-1-5-13(14)11-4-3-7-21-9-11/h1-10H,(H4,19,20,22,23,24) |
| InChIKey | PGVJESMCPBRKFE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 103.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.35 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine?
The IUPAC name of 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine (CID 155555328) is 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine.
What is the SMILES notation for 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine?
The canonical SMILES for 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine is Nc1ncc2cc(-c3ccccc3-c3cccnc3)c(N)nc2n1.
What is the InChIKey of 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine?
The InChIKey is PGVJESMCPBRKFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14N6/c19-16-15(8-12-10-22-18(20)24-17(12)23-16)14-6-2-1-5-13(14)11-4-3-7-21-9-11/h1-10H,(H4,19,20,22,23,24).
What are the key properties of 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine?
6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine has a molecular weight of 314.35 g/mol, XLogP of 2.92, 2 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2-pyridin-3-ylphenyl)pyrido[2,3-d]pyrimidine-2,7-diamine is sourced from PubChem (CID 155555328), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).