C27H33ClN10O — CID 155555422
9-[2-[3-[3-[(2-chloro-6-methoxyacridin-9-yl)amino]propylamino]propylamino]ethyl]purine-2,6-diamine (PubChem CID 155555422) has the molecular formula C27H33ClN10O and a molecular weight of 549.08 g/mol. Its IUPAC name is 9-[2-[3-[3-[(2-chloro-6-methoxyacridin-9-yl)amino]propylamino]propylamino]ethyl]purine-2,6-diamine.
| Compound Name | 9-[2-[3-[3-[(2-chloro-6-methoxyacridin-9-yl)amino]propylamino]propylamino]ethyl]purine-2,6-diamine |
|---|---|
| PubChem CID | 155555422 |
| Molecular Formula | C27H33ClN10O |
| Molecular Weight | 549.08 g/mol |
| Exact Mass | 548.25 |
| IUPAC Name | 9-[2-[3-[3-[(2-chloro-6-methoxyacridin-9-yl)amino]propylamino]propylamino]ethyl]purine-2,6-diamine |
| SMILES | COc1ccc2c(NCCCNCCCNCCn3cnc4c(N)nc(N)nc43)c3cc(Cl)ccc3nc2c1 |
| InChI | InChI=1S/C27H33ClN10O/c1-39-18-5-6-19-22(15-18)35-21-7-4-17(28)14-20(21)23(19)33-11-3-10-31-8-2-9-32-12-13-38-16-34-24-25(29)36-27(30)37-26(24)38/h4-7,14-16,31-32H,2-3,8-13H2,1H3,(H,33,35)(H4,29,30,36,37) |
| InChIKey | HUECDWNFKHUSOF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 153.85 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.08 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'amino_acridine_A(46)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|