C16H26O — CID 155555632
(1R,3aS,8aS)-7-ethyl-3a-methyl-1-propan-2-yl-1,2,3,5,6,8a-hexahydroazulen-4-one (PubChem CID 155555632) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is (1R,3aS,8aS)-7-ethyl-3a-methyl-1-propan-2-yl-1,2,3,5,6,8a-hexahydroazulen-4-one.
| Compound Name | (1R,3aS,8aS)-7-ethyl-3a-methyl-1-propan-2-yl-1,2,3,5,6,8a-hexahydroazulen-4-one |
|---|---|
| PubChem CID | 155555632 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | (1R,3aS,8aS)-7-ethyl-3a-methyl-1-propan-2-yl-1,2,3,5,6,8a-hexahydroazulen-4-one |
| SMILES | CCC1=C[C@@H]2[C@@H](C(C)C)CC[C@]2(C)C(=O)CC1 |
| InChI | InChI=1S/C16H26O/c1-5-12-6-7-15(17)16(4)9-8-13(11(2)3)14(16)10-12/h10-11,13-14H,5-9H2,1-4H3/t13-,14-,16+/m1/s1 |
| InChIKey | VCIXCIDCKLDYBT-FMKPAKJESA-N |
| XLogP | 4.37 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|