C34H34N8O4S — CID 155555703
9H-fluoren-9-ylmethyl N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate (PubChem CID 155555703) has the molecular formula C34H34N8O4S and a molecular weight of 650.77 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 155555703 |
| Molecular Formula | C34H34N8O4S |
| Molecular Weight | 650.77 g/mol |
| Exact Mass | 650.24 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2S)-1-[[(2S)-1-(1,3-benzothiazol-2-yl)-5-(diaminomethylideneamino)-1-oxopentan-2-yl]amino]-3-(1H-imidazol-5-yl)-1-oxopropan-2-yl]carbamate |
| SMILES | NC(N)=NCCC[C@H](NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)c1nc2ccccc2s1 |
| InChI | InChI=1S/C34H34N8O4S/c35-33(36)38-15-7-13-27(30(43)32-41-26-12-5-6-14-29(26)47-32)40-31(44)28(16-20-17-37-19-39-20)42-34(45)46-18-25-23-10-3-1-8-21(23)22-9-2-4-11-24(22)25/h1-6,8-12,14,17,19,25,27-28H,7,13,15-16,18H2,(H,37,39)(H,40,44)(H,42,45)(H4,35,36,38)/t27-,28-/m0/s1 |
| InChIKey | VIPGDRKEADGMFI-NSOVKSMOSA-N |
| XLogP | 3.89 |
| TPSA | 190.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.77 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|