C15H22N6O4 — CID 155555752
1-[6-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)hexyl]-N-hydroxy-1,2,4-triazole-3-carboxamide (PubChem CID 155555752) has the molecular formula C15H22N6O4 and a molecular weight of 350.38 g/mol. Its IUPAC name is 1-[6-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)hexyl]-N-hydroxy-1,2,4-triazole-3-carboxamide.
| Compound Name | 1-[6-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)hexyl]-N-hydroxy-1,2,4-triazole-3-carboxamide |
|---|---|
| PubChem CID | 155555752 |
| Molecular Formula | C15H22N6O4 |
| Molecular Weight | 350.38 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 1-[6-(3,6-dimethyl-2,4-dioxopyrimidin-1-yl)hexyl]-N-hydroxy-1,2,4-triazole-3-carboxamide |
| SMILES | Cc1cc(=O)n(C)c(=O)n1CCCCCCn1cnc(C(=O)NO)n1 |
| InChI | InChI=1S/C15H22N6O4/c1-11-9-12(22)19(2)15(24)21(11)8-6-4-3-5-7-20-10-16-13(17-20)14(23)18-25/h9-10,25H,3-8H2,1-2H3,(H,18,23) |
| InChIKey | JHMVJWUKEQFLDA-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 124.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.38 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|