C29H34N6O3S2 — CID 155555806
3-(2-methoxyethylamino)-N-[3-[5-(6-morpholin-4-yl-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide (PubChem CID 155555806) has the molecular formula C29H34N6O3S2 and a molecular weight of 578.76 g/mol. Its IUPAC name is 3-(2-methoxyethylamino)-N-[3-[5-(6-morpholin-4-yl-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide.
| Compound Name | 3-(2-methoxyethylamino)-N-[3-[5-(6-morpholin-4-yl-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
|---|---|
| PubChem CID | 155555806 |
| Molecular Formula | C29H34N6O3S2 |
| Molecular Weight | 578.76 g/mol |
| Exact Mass | 578.21 |
| IUPAC Name | 3-(2-methoxyethylamino)-N-[3-[5-(6-morpholin-4-yl-3-pyridinyl)-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4ccc(N5CCOCC5)nc4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C29H34N6O3S2/c1-37-13-10-30-9-7-26(36)34-29-27(21-6-8-31-18-24(21)40-29)28-33-22-16-19(2-4-23(22)39-28)20-3-5-25(32-17-20)35-11-14-38-15-12-35/h2-5,16-17,30-31H,6-15,18H2,1H3,(H,34,36) |
| InChIKey | SUOWPLSCBOGQLS-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 100.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.76 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|