About 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide
4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide (PubChem CID 155555817) has the molecular formula C12H9N3O3S2
and a molecular weight of 307.36 g/mol. Its IUPAC name is 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide.
Molecular Properties
| Compound Name | 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide |
| PubChem CID | 155555817 |
| Molecular Formula | C12H9N3O3S2 |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.01 |
| IUPAC Name | 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide |
| SMILES | NS(=O)(=O)c1cc(-c2nc(-c3ccccc3)no2)cs1 |
| InChI | InChI=1S/C12H9N3O3S2/c13-20(16,17)10-6-9(7-19-10)12-14-11(15-18-12)8-4-2-1-3-5-8/h1-7H,(H2,13,16,17) |
| InChIKey | DNEQUSLFWXCBKT-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 99.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide?
The IUPAC name of 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide (CID 155555817) is 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide.
What is the SMILES notation for 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide?
The canonical SMILES for 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide is NS(=O)(=O)c1cc(-c2nc(-c3ccccc3)no2)cs1.
What is the InChIKey of 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide?
The InChIKey is DNEQUSLFWXCBKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9N3O3S2/c13-20(16,17)10-6-9(7-19-10)12-14-11(15-18-12)8-4-2-1-3-5-8/h1-7H,(H2,13,16,17).
What are the key properties of 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide?
4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide has a molecular weight of 307.36 g/mol, XLogP of 2.11, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3-phenyl-1,2,4-oxadiazol-5-yl)thiophene-2-sulfonamide is sourced from PubChem (CID 155555817), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).