C23H30N2O — CID 155555847
(12aS)-7,7,9,12a-tetramethyl-2-propan-2-yloxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline (PubChem CID 155555847) has the molecular formula C23H30N2O and a molecular weight of 350.51 g/mol. Its IUPAC name is (12aS)-7,7,9,12a-tetramethyl-2-propan-2-yloxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline.
| Compound Name | (12aS)-7,7,9,12a-tetramethyl-2-propan-2-yloxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline |
|---|---|
| PubChem CID | 155555847 |
| Molecular Formula | C23H30N2O |
| Molecular Weight | 350.51 g/mol |
| Exact Mass | 350.24 |
| IUPAC Name | (12aS)-7,7,9,12a-tetramethyl-2-propan-2-yloxy-5,6,6a,12-tetrahydronaphtho[1,2-g]quinazoline |
| SMILES | Cc1ncc2c(n1)C(C)(C)C1CCc3ccc(OC(C)C)cc3[C@@]1(C)C2 |
| InChI | InChI=1S/C23H30N2O/c1-14(2)26-18-9-7-16-8-10-20-22(4,5)21-17(13-24-15(3)25-21)12-23(20,6)19(16)11-18/h7,9,11,13-14,20H,8,10,12H2,1-6H3/t20?,23-/m1/s1 |
| InChIKey | MXQYRDRJXBQJCF-GWQXNCQPSA-N |
| XLogP | 4.93 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.51 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |