About N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine
N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine (PubChem CID 155555871) has the molecular formula C19H21N3O
and a molecular weight of 307.40 g/mol. Its IUPAC name is N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine.
Molecular Properties
| Compound Name | N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine |
| PubChem CID | 155555871 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine |
| SMILES | CCN(c1ccccn1)c1cc(-c2c(C)noc2C)ccc1C |
| InChI | InChI=1S/C19H21N3O/c1-5-22(18-8-6-7-11-20-18)17-12-16(10-9-13(17)2)19-14(3)21-23-15(19)4/h6-12H,5H2,1-4H3 |
| InChIKey | OPZRFIFVMBZUTM-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 42.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine?
The IUPAC name of N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine (CID 155555871) is N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine.
What is the SMILES notation for N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine?
The canonical SMILES for N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine is CCN(c1ccccn1)c1cc(-c2c(C)noc2C)ccc1C.
What is the InChIKey of N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine?
The InChIKey is OPZRFIFVMBZUTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H21N3O/c1-5-22(18-8-6-7-11-20-18)17-12-16(10-9-13(17)2)19-14(3)21-23-15(19)4/h6-12H,5H2,1-4H3.
What are the key properties of N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine?
N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine has a molecular weight of 307.40 g/mol, XLogP of 4.82, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[5-(3,5-dimethyl-1,2-oxazol-4-yl)-2-methylphenyl]-N-ethylpyridin-2-amine is sourced from PubChem (CID 155555871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).