C19H16N8O4S — CID 155555874
7-methyl-5-oxo-N-[(E)-pyridin-4-ylmethylideneamino]-1-(4-sulfamoylphenyl)-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide (PubChem CID 155555874) has the molecular formula C19H16N8O4S and a molecular weight of 452.46 g/mol. Its IUPAC name is 7-methyl-5-oxo-N-[(E)-pyridin-4-ylmethylideneamino]-1-(4-sulfamoylphenyl)-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide.
| Compound Name | 7-methyl-5-oxo-N-[(E)-pyridin-4-ylmethylideneamino]-1-(4-sulfamoylphenyl)-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 155555874 |
| Molecular Formula | C19H16N8O4S |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | 7-methyl-5-oxo-N-[(E)-pyridin-4-ylmethylideneamino]-1-(4-sulfamoylphenyl)-[1,2,4]triazolo[4,3-a]pyrimidine-3-carboxamide |
| SMILES | Cc1cc(=O)n2c(C(=O)N/N=C/c3ccncc3)nn(-c3ccc(S(N)(=O)=O)cc3)c2n1 |
| InChI | InChI=1S/C19H16N8O4S/c1-12-10-16(28)26-17(18(29)24-22-11-13-6-8-21-9-7-13)25-27(19(26)23-12)14-2-4-15(5-3-14)32(20,30)31/h2-11H,1H3,(H,24,29)(H2,20,30,31)/b22-11+ |
| InChIKey | PZUANRKCVPJDIX-SSDVNMTOSA-N |
| XLogP | -0.01 |
| TPSA | 166.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|