C27H36O6 — CID 155555927
3-[(2E,6E)-10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-hydroxy-6-(4-methoxyphenyl)pyran-2-one (PubChem CID 155555927) has the molecular formula C27H36O6 and a molecular weight of 456.58 g/mol. Its IUPAC name is 3-[(2E,6E)-10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-hydroxy-6-(4-methoxyphenyl)pyran-2-one.
| Compound Name | 3-[(2E,6E)-10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-hydroxy-6-(4-methoxyphenyl)pyran-2-one |
|---|---|
| PubChem CID | 155555927 |
| Molecular Formula | C27H36O6 |
| Molecular Weight | 456.58 g/mol |
| Exact Mass | 456.25 |
| IUPAC Name | 3-[(2E,6E)-10,11-dihydroxy-3,7,11-trimethyldodeca-2,6-dienyl]-4-hydroxy-6-(4-methoxyphenyl)pyran-2-one |
| SMILES | COc1ccc(-c2cc(O)c(C/C=C(\C)CC/C=C(\C)CCC(O)C(C)(C)O)c(=O)o2)cc1 |
| InChI | InChI=1S/C27H36O6/c1-18(7-6-8-19(2)10-16-25(29)27(3,4)31)9-15-22-23(28)17-24(33-26(22)30)20-11-13-21(32-5)14-12-20/h8-9,11-14,17,25,28-29,31H,6-7,10,15-16H2,1-5H3/b18-9+,19-8+ |
| InChIKey | MGSYRNYGQKPWRZ-JRCNGKPYSA-N |
| XLogP | 5.15 |
| TPSA | 100.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|