About 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole
2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole (PubChem CID 155555930) has the molecular formula C34H25N5O
and a molecular weight of 519.61 g/mol. Its IUPAC name is 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole.
Molecular Properties
| Compound Name | 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole |
| PubChem CID | 155555930 |
| Molecular Formula | C34H25N5O |
| Molecular Weight | 519.61 g/mol |
| Exact Mass | 519.21 |
| IUPAC Name | 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole |
| SMILES | Cn1cc(-c2nnc(-c3ccc(C(c4c[nH]c5ccccc45)c4c[nH]c5ccccc45)cc3)o2)c2ccccc21 |
| InChI | InChI=1S/C34H25N5O/c1-39-20-28(25-10-4-7-13-31(25)39)34-38-37-33(40-34)22-16-14-21(15-17-22)32(26-18-35-29-11-5-2-8-23(26)29)27-19-36-30-12-6-3-9-24(27)30/h2-20,32,35-36H,1H3 |
| InChIKey | WQUQPOMJKPDRKK-UHFFFAOYSA-N |
| XLogP | 8.04 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 519.61 |
| LogP ≤ 5 | 8.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole?
The IUPAC name of 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole (CID 155555930) is 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole.
What is the SMILES notation for 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole?
The canonical SMILES for 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole is Cn1cc(-c2nnc(-c3ccc(C(c4c[nH]c5ccccc45)c4c[nH]c5ccccc45)cc3)o2)c2ccccc21.
What is the InChIKey of 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole?
The InChIKey is WQUQPOMJKPDRKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C34H25N5O/c1-39-20-28(25-10-4-7-13-31(25)39)34-38-37-33(40-34)22-16-14-21(15-17-22)32(26-18-35-29-11-5-2-8-23(26)29)27-19-36-30-12-6-3-9-24(27)30/h2-20,32,35-36H,1H3.
What are the key properties of 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole?
2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole has a molecular weight of 519.61 g/mol, XLogP of 8.04, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-[bis(1H-indol-3-yl)methyl]phenyl]-5-(1-methylindol-3-yl)-1,3,4-oxadiazole is sourced from PubChem (CID 155555930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).