C21H25ClN2O4S — CID 155556100
butyl (6R,7R)-7-[3-(4-chlorophenyl)propanoylamino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 155556100) has the molecular formula C21H25ClN2O4S and a molecular weight of 436.96 g/mol. Its IUPAC name is butyl (6R,7R)-7-[3-(4-chlorophenyl)propanoylamino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | butyl (6R,7R)-7-[3-(4-chlorophenyl)propanoylamino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 155556100 |
| Molecular Formula | C21H25ClN2O4S |
| Molecular Weight | 436.96 g/mol |
| Exact Mass | 436.12 |
| IUPAC Name | butyl (6R,7R)-7-[3-(4-chlorophenyl)propanoylamino]-3-methyl-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | CCCCOC(=O)C1=C(C)CS[C@@H]2[C@H](NC(=O)CCc3ccc(Cl)cc3)C(=O)N12 |
| InChI | InChI=1S/C21H25ClN2O4S/c1-3-4-11-28-21(27)18-13(2)12-29-20-17(19(26)24(18)20)23-16(25)10-7-14-5-8-15(22)9-6-14/h5-6,8-9,17,20H,3-4,7,10-12H2,1-2H3,(H,23,25)/t17-,20-/m1/s1 |
| InChIKey | CPDLVJFHHYPLAN-YLJYHZDGSA-N |
| XLogP | 3.29 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.96 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|