C28H24Br2NO2+ — CID 155556342
[4-[(2E)-2-[4,6-bis(4-bromophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-hydroxyethyl)-methylazanium (PubChem CID 155556342) has the molecular formula C28H24Br2NO2+ and a molecular weight of 566.31 g/mol. Its IUPAC name is [4-[(2E)-2-[4,6-bis(4-bromophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-hydroxyethyl)-methylazanium.
| Compound Name | [4-[(2E)-2-[4,6-bis(4-bromophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-hydroxyethyl)-methylazanium |
|---|---|
| PubChem CID | 155556342 |
| Molecular Formula | C28H24Br2NO2+ |
| Molecular Weight | 566.31 g/mol |
| Exact Mass | 564.02 |
| IUPAC Name | [4-[(2E)-2-[4,6-bis(4-bromophenyl)pyran-2-ylidene]ethylidene]cyclohexa-2,5-dien-1-ylidene]-(2-hydroxyethyl)-methylazanium |
| SMILES | C[N+](CCO)=C1C=CC(=C/C=C2\C=C(c3ccc(Br)cc3)C=C(c3ccc(Br)cc3)O2)C=C1 |
| InChI | InChI=1S/C28H24Br2NO2/c1-31(16-17-32)26-13-2-20(3-14-26)4-15-27-18-23(21-5-9-24(29)10-6-21)19-28(33-27)22-7-11-25(30)12-8-22/h2-15,18-19,32H,16-17H2,1H3/q+1/b20-4-,27-15+,31-26+ |
| InChIKey | TUOHHNPVJJNWNE-SRGWSVECSA-N |
| XLogP | 6.68 |
| TPSA | 32.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.31 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|