About 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid
2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid (PubChem CID 155556567) has the molecular formula C5H8N2O2S
and a molecular weight of 160.20 g/mol. Its IUPAC name is 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid.
Molecular Properties
| Compound Name | 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid |
| PubChem CID | 155556567 |
| Molecular Formula | C5H8N2O2S |
| Molecular Weight | 160.20 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid |
| SMILES | NC1=N[C@@H](CC(=O)O)CS1 |
| InChI | InChI=1S/C5H8N2O2S/c6-5-7-3(2-10-5)1-4(8)9/h3H,1-2H2,(H2,6,7)(H,8,9)/t3-/m0/s1 |
| InChIKey | ANCWBXJZUCHVHL-VKHMYHEASA-N |
| XLogP | -0.11 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.20 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid?
The IUPAC name of 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid (CID 155556567) is 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid.
What is the SMILES notation for 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid?
The canonical SMILES for 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid is NC1=N[C@@H](CC(=O)O)CS1.
What is the InChIKey of 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid?
The InChIKey is ANCWBXJZUCHVHL-VKHMYHEASA-N. The full InChI is InChI=1S/C5H8N2O2S/c6-5-7-3(2-10-5)1-4(8)9/h3H,1-2H2,(H2,6,7)(H,8,9)/t3-/m0/s1.
What are the key properties of 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid?
2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid has a molecular weight of 160.20 g/mol, XLogP of -0.11, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(4S)-2-amino-4,5-dihydro-1,3-thiazol-4-yl]acetic acid is sourced from PubChem (CID 155556567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).