About (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one
(6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one (PubChem CID 155556592) has the molecular formula C17H12O5
and a molecular weight of 296.28 g/mol. Its IUPAC name is (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one.
Molecular Properties
| Compound Name | (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one |
| PubChem CID | 155556592 |
| Molecular Formula | C17H12O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one |
| SMILES | O=C1/C(=C/c2ccc(O)c(O)c2)Cc2cc3c(cc21)OCO3 |
| InChI | InChI=1S/C17H12O5/c18-13-2-1-9(4-14(13)19)3-11-5-10-6-15-16(22-8-21-15)7-12(10)17(11)20/h1-4,6-7,18-19H,5,8H2/b11-3+ |
| InChIKey | XFLNZDWKDFCPNO-QDEBKDIKSA-N |
| XLogP | 2.65 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one?
The IUPAC name of (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one (CID 155556592) is (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one.
What is the SMILES notation for (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one?
The canonical SMILES for (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one is O=C1/C(=C/c2ccc(O)c(O)c2)Cc2cc3c(cc21)OCO3.
What is the InChIKey of (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one?
The InChIKey is XFLNZDWKDFCPNO-QDEBKDIKSA-N. The full InChI is InChI=1S/C17H12O5/c18-13-2-1-9(4-14(13)19)3-11-5-10-6-15-16(22-8-21-15)7-12(10)17(11)20/h1-4,6-7,18-19H,5,8H2/b11-3+.
What are the key properties of (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one?
(6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one has a molecular weight of 296.28 g/mol, XLogP of 2.65, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (6E)-6-[(3,4-dihydroxyphenyl)methylidene]-5H-cyclopenta[f][1,3]benzodioxol-7-one is sourced from PubChem (CID 155556592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).