C19H28N4S — CID 155556665
4,4-dimethyl-1-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperidine (PubChem CID 155556665) has the molecular formula C19H28N4S and a molecular weight of 344.53 g/mol. Its IUPAC name is 4,4-dimethyl-1-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperidine.
| Compound Name | 4,4-dimethyl-1-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperidine |
|---|---|
| PubChem CID | 155556665 |
| Molecular Formula | C19H28N4S |
| Molecular Weight | 344.53 g/mol |
| Exact Mass | 344.20 |
| IUPAC Name | 4,4-dimethyl-1-[3-[(4-methyl-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]propyl]piperidine |
| SMILES | Cn1c(SCCCN2CCC(C)(C)CC2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C19H28N4S/c1-19(2)10-13-23(14-11-19)12-7-15-24-18-21-20-17(22(18)3)16-8-5-4-6-9-16/h4-6,8-9H,7,10-15H2,1-3H3 |
| InChIKey | KNJYSVPTKHXEGZ-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 33.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.53 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|