C16H22F2N4O2 — CID 155556675
N'-(5,6-difluoro-3-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide (PubChem CID 155556675) has the molecular formula C16H22F2N4O2 and a molecular weight of 340.37 g/mol. Its IUPAC name is N'-(5,6-difluoro-3-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide.
| Compound Name | N'-(5,6-difluoro-3-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
|---|---|
| PubChem CID | 155556675 |
| Molecular Formula | C16H22F2N4O2 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N'-(5,6-difluoro-3-pyridinyl)-N-(2,2,6,6-tetramethylpiperidin-4-yl)oxamide |
| SMILES | CC1(C)CC(NC(=O)C(=O)Nc2cnc(F)c(F)c2)CC(C)(C)N1 |
| InChI | InChI=1S/C16H22F2N4O2/c1-15(2)6-10(7-16(3,4)22-15)21-14(24)13(23)20-9-5-11(17)12(18)19-8-9/h5,8,10,22H,6-7H2,1-4H3,(H,20,23)(H,21,24) |
| InChIKey | MQZRSIMQTSZLLU-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|