C21H14F6N2O — CID 155556750
(1E,3E,6E,8E)-1,9-bis[6-(trifluoromethyl)-3-pyridinyl]nona-1,3,6,8-tetraen-5-one (PubChem CID 155556750) has the molecular formula C21H14F6N2O and a molecular weight of 424.34 g/mol. Its IUPAC name is (1E,3E,6E,8E)-1,9-bis[6-(trifluoromethyl)-3-pyridinyl]nona-1,3,6,8-tetraen-5-one.
| Compound Name | (1E,3E,6E,8E)-1,9-bis[6-(trifluoromethyl)-3-pyridinyl]nona-1,3,6,8-tetraen-5-one |
|---|---|
| PubChem CID | 155556750 |
| Molecular Formula | C21H14F6N2O |
| Molecular Weight | 424.34 g/mol |
| Exact Mass | 424.10 |
| IUPAC Name | (1E,3E,6E,8E)-1,9-bis[6-(trifluoromethyl)-3-pyridinyl]nona-1,3,6,8-tetraen-5-one |
| SMILES | O=C(/C=C/C=C/c1ccc(C(F)(F)F)nc1)/C=C/C=C/c1ccc(C(F)(F)F)nc1 |
| InChI | InChI=1S/C21H14F6N2O/c22-20(23,24)18-11-9-15(13-28-18)5-1-3-7-17(30)8-4-2-6-16-10-12-19(29-14-16)21(25,26)27/h1-14H/b5-1+,6-2+,7-3+,8-4+ |
| InChIKey | GEOCTVXWXVLISV-VYUKIJHXSA-N |
| XLogP | 5.92 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.34 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|