C12H12BrN5OS — CID 155556852
1-(4-bromophenyl)-3-[5-(prop-2-enylamino)-1,2,4-thiadiazol-3-yl]urea (PubChem CID 155556852) has the molecular formula C12H12BrN5OS and a molecular weight of 354.23 g/mol. Its IUPAC name is 1-(4-bromophenyl)-3-[5-(prop-2-enylamino)-1,2,4-thiadiazol-3-yl]urea.
| Compound Name | 1-(4-bromophenyl)-3-[5-(prop-2-enylamino)-1,2,4-thiadiazol-3-yl]urea |
|---|---|
| PubChem CID | 155556852 |
| Molecular Formula | C12H12BrN5OS |
| Molecular Weight | 354.23 g/mol |
| Exact Mass | 352.99 |
| IUPAC Name | 1-(4-bromophenyl)-3-[5-(prop-2-enylamino)-1,2,4-thiadiazol-3-yl]urea |
| SMILES | C=CCNc1nc(NC(=O)Nc2ccc(Br)cc2)ns1 |
| InChI | InChI=1S/C12H12BrN5OS/c1-2-7-14-12-17-10(18-20-12)16-11(19)15-9-5-3-8(13)4-6-9/h2-6H,1,7H2,(H3,14,15,16,17,18,19) |
| InChIKey | JYTHDZIAUBWXAL-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 78.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.23 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|