C20H18ClN5 — CID 155556936
2-[[1-(3-chlorophenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 155556936) has the molecular formula C20H18ClN5 and a molecular weight of 363.85 g/mol. Its IUPAC name is 2-[[1-(3-chlorophenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-[[1-(3-chlorophenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 155556936 |
| Molecular Formula | C20H18ClN5 |
| Molecular Weight | 363.85 g/mol |
| Exact Mass | 363.13 |
| IUPAC Name | 2-[[1-(3-chlorophenyl)triazol-4-yl]methyl]-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | Clc1cccc(-n2cc(CN3CCc4c([nH]c5ccccc45)C3)nn2)c1 |
| InChI | InChI=1S/C20H18ClN5/c21-14-4-3-5-16(10-14)26-12-15(23-24-26)11-25-9-8-18-17-6-1-2-7-19(17)22-20(18)13-25/h1-7,10,12,22H,8-9,11,13H2 |
| InChIKey | KJLWOPFHIVZPST-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 49.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.85 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|