About ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate
ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate (PubChem CID 155557279) has the molecular formula C31H29NO7
and a molecular weight of 527.57 g/mol. Its IUPAC name is ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate |
| PubChem CID | 155557279 |
| Molecular Formula | C31H29NO7 |
| Molecular Weight | 527.57 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(OC)cc2)oc2ccc(OCCCCCN3C(=O)C(=O)c4ccccc43)cc12 |
| InChI | InChI=1S/C31H29NO7/c1-3-37-31(35)27-24-19-22(15-16-26(24)39-29(27)20-11-13-21(36-2)14-12-20)38-18-8-4-7-17-32-25-10-6-5-9-23(25)28(33)30(32)34/h5-6,9-16,19H,3-4,7-8,17-18H2,1-2H3 |
| InChIKey | OXWCXFWZLVMSKT-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 95.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 527.57 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate?
The IUPAC name of ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate (CID 155557279) is ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate.
What is the SMILES notation for ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate?
The canonical SMILES for ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate is CCOC(=O)c1c(-c2ccc(OC)cc2)oc2ccc(OCCCCCN3C(=O)C(=O)c4ccccc43)cc12.
What is the InChIKey of ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate?
The InChIKey is OXWCXFWZLVMSKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C31H29NO7/c1-3-37-31(35)27-24-19-22(15-16-26(24)39-29(27)20-11-13-21(36-2)14-12-20)38-18-8-4-7-17-32-25-10-6-5-9-23(25)28(33)30(32)34/h5-6,9-16,19H,3-4,7-8,17-18H2,1-2H3.
What are the key properties of ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate?
ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate has a molecular weight of 527.57 g/mol, XLogP of 6.06, 11 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-[5-(2,3-dioxoindol-1-yl)pentoxy]-2-(4-methoxyphenyl)-1-benzofuran-3-carboxylate is sourced from PubChem (CID 155557279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).