About N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine
N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine (PubChem CID 155557451) has the molecular formula C23H15N7O4
and a molecular weight of 453.42 g/mol. Its IUPAC name is N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine.
Molecular Properties
| Compound Name | N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine |
| PubChem CID | 155557451 |
| Molecular Formula | C23H15N7O4 |
| Molecular Weight | 453.42 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine |
| SMILES | O=[N+]([O-])c1ccc(-n2cc(-c3cccc(Nc4ncnc5cc6c(cc45)OCO6)c3)nn2)cc1 |
| InChI | InChI=1S/C23H15N7O4/c31-30(32)17-6-4-16(5-7-17)29-11-20(27-28-29)14-2-1-3-15(8-14)26-23-18-9-21-22(34-13-33-21)10-19(18)24-12-25-23/h1-12H,13H2,(H,24,25,26) |
| InChIKey | DKFDNKBYODVQCZ-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 130.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 453.42 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine?
The IUPAC name of N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine (CID 155557451) is N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine.
What is the SMILES notation for N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine?
The canonical SMILES for N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine is O=[N+]([O-])c1ccc(-n2cc(-c3cccc(Nc4ncnc5cc6c(cc45)OCO6)c3)nn2)cc1.
What is the InChIKey of N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine?
The InChIKey is DKFDNKBYODVQCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H15N7O4/c31-30(32)17-6-4-16(5-7-17)29-11-20(27-28-29)14-2-1-3-15(8-14)26-23-18-9-21-22(34-13-33-21)10-19(18)24-12-25-23/h1-12H,13H2,(H,24,25,26).
What are the key properties of N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine?
N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine has a molecular weight of 453.42 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-[1-(4-nitrophenyl)triazol-4-yl]phenyl]-[1,3]dioxolo[4,5-g]quinazolin-8-amine is sourced from PubChem (CID 155557451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).