C17H20O5 — CID 155557454
[(4aR,5R,6R,7R)-7-hydroxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate (PubChem CID 155557454) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is [(4aR,5R,6R,7R)-7-hydroxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate.
| Compound Name | [(4aR,5R,6R,7R)-7-hydroxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate |
|---|---|
| PubChem CID | 155557454 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | [(4aR,5R,6R,7R)-7-hydroxy-3,4a,5-trimethyl-2-oxo-4,5,6,7-tetrahydrobenzo[f][1]benzofuran-6-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@H](O)C=C2C=C3OC(=O)C(C)=C3C[C@]2(C)[C@H]1C |
| InChI | InChI=1S/C17H20O5/c1-8-12-7-17(4)9(2)15(21-10(3)18)13(19)5-11(17)6-14(12)22-16(8)20/h5-6,9,13,15,19H,7H2,1-4H3/t9-,13+,15+,17+/m0/s1 |
| InChIKey | BVVRFLKHDORYLD-DFLVHYAOSA-N |
| XLogP | 2.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |