C31H28NO4+ — CID 155557463
5,6-dimethoxy-8-phenyl-20-propyl-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene (PubChem CID 155557463) has the molecular formula C31H28NO4+ and a molecular weight of 478.57 g/mol. Its IUPAC name is 5,6-dimethoxy-8-phenyl-20-propyl-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene.
| Compound Name | 5,6-dimethoxy-8-phenyl-20-propyl-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene |
|---|---|
| PubChem CID | 155557463 |
| Molecular Formula | C31H28NO4+ |
| Molecular Weight | 478.57 g/mol |
| Exact Mass | 478.20 |
| IUPAC Name | 5,6-dimethoxy-8-phenyl-20-propyl-15,17-dioxa-9-azoniahexacyclo[10.9.2.02,7.09,22.014,18.019,23]tricosa-1,3,5,7,9(22),12,14(18),19(23),20-nonaene |
| SMILES | CCCc1cc2c3ccc(OC)c(OC)c3c(-c3ccccc3)[n+]3c2c2c(cc4c(c12)OCO4)CC3 |
| InChI | InChI=1S/C31H28NO4/c1-4-8-19-15-22-21-11-12-23(33-2)30(34-3)27(21)28(18-9-6-5-7-10-18)32-14-13-20-16-24-31(36-17-35-24)26(19)25(20)29(22)32/h5-7,9-12,15-16H,4,8,13-14,17H2,1-3H3/q+1 |
| InChIKey | BEYZVJDAZPZGRY-UHFFFAOYSA-N |
| XLogP | 6.36 |
| TPSA | 40.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.57 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|