About [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate
[3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate (PubChem CID 155557507) has the molecular formula C21H18N4OS3
and a molecular weight of 438.60 g/mol. Its IUPAC name is [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate.
Molecular Properties
| Compound Name | [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate |
| PubChem CID | 155557507 |
| Molecular Formula | C21H18N4OS3 |
| Molecular Weight | 438.60 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate |
| SMILES | O=C(CCSC(=S)NCc1cccnc1)c1cn(-c2cccs2)c2ncccc12 |
| InChI | InChI=1S/C21H18N4OS3/c26-18(7-11-29-21(27)24-13-15-4-1-8-22-12-15)17-14-25(19-6-3-10-28-19)20-16(17)5-2-9-23-20/h1-6,8-10,12,14H,7,11,13H2,(H,24,27) |
| InChIKey | UGLOCGAOEQEDFM-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 438.60 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_carbam_A(1)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate?
The IUPAC name of [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate (CID 155557507) is [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate.
What is the SMILES notation for [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate?
The canonical SMILES for [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate is O=C(CCSC(=S)NCc1cccnc1)c1cn(-c2cccs2)c2ncccc12.
What is the InChIKey of [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate?
The InChIKey is UGLOCGAOEQEDFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18N4OS3/c26-18(7-11-29-21(27)24-13-15-4-1-8-22-12-15)17-14-25(19-6-3-10-28-19)20-16(17)5-2-9-23-20/h1-6,8-10,12,14H,7,11,13H2,(H,24,27).
What are the key properties of [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate?
[3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate has a molecular weight of 438.60 g/mol, XLogP of 4.86, 7 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [3-oxo-3-(1-thiophen-2-ylpyrrolo[2,3-b]pyridin-3-yl)propyl] N-(pyridin-3-ylmethyl)carbamodithioate is sourced from PubChem (CID 155557507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).