About ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate
ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate (PubChem CID 155557593) has the molecular formula C23H27NO4
and a molecular weight of 381.47 g/mol. Its IUPAC name is ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate |
| PubChem CID | 155557593 |
| Molecular Formula | C23H27NO4 |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate |
| SMILES | CCOC(=O)c1c(C2COC3(CCCCC3)O2)cc(-c2ccccc2)nc1C |
| InChI | InChI=1S/C23H27NO4/c1-3-26-22(25)21-16(2)24-19(17-10-6-4-7-11-17)14-18(21)20-15-27-23(28-20)12-8-5-9-13-23/h4,6-7,10-11,14,20H,3,5,8-9,12-13,15H2,1-2H3 |
| InChIKey | AXAQVIBGNLYJTI-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate?
The IUPAC name of ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate (CID 155557593) is ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate.
What is the SMILES notation for ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate?
The canonical SMILES for ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate is CCOC(=O)c1c(C2COC3(CCCCC3)O2)cc(-c2ccccc2)nc1C.
What is the InChIKey of ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate?
The InChIKey is AXAQVIBGNLYJTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27NO4/c1-3-26-22(25)21-16(2)24-19(17-10-6-4-7-11-17)14-18(21)20-15-27-23(28-20)12-8-5-9-13-23/h4,6-7,10-11,14,20H,3,5,8-9,12-13,15H2,1-2H3.
What are the key properties of ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate?
ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate has a molecular weight of 381.47 g/mol, XLogP of 4.98, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-(1,4-dioxaspiro[4.5]decan-3-yl)-2-methyl-6-phenylpyridine-3-carboxylate is sourced from PubChem (CID 155557593), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).