C44H35N5O — CID 155557816
(3E,5E)-1-benzyl-3,5-bis[(1,3-diphenylpyrazol-4-yl)methylidene]piperidin-4-one (PubChem CID 155557816) has the molecular formula C44H35N5O and a molecular weight of 649.80 g/mol. Its IUPAC name is (3E,5E)-1-benzyl-3,5-bis[(1,3-diphenylpyrazol-4-yl)methylidene]piperidin-4-one.
| Compound Name | (3E,5E)-1-benzyl-3,5-bis[(1,3-diphenylpyrazol-4-yl)methylidene]piperidin-4-one |
|---|---|
| PubChem CID | 155557816 |
| Molecular Formula | C44H35N5O |
| Molecular Weight | 649.80 g/mol |
| Exact Mass | 649.28 |
| IUPAC Name | (3E,5E)-1-benzyl-3,5-bis[(1,3-diphenylpyrazol-4-yl)methylidene]piperidin-4-one |
| SMILES | O=C1/C(=C/c2cn(-c3ccccc3)nc2-c2ccccc2)CN(Cc2ccccc2)C/C1=C\c1cn(-c2ccccc2)nc1-c1ccccc1 |
| InChI | InChI=1S/C44H35N5O/c50-44-38(26-36-31-48(40-22-12-4-13-23-40)45-42(36)34-18-8-2-9-19-34)29-47(28-33-16-6-1-7-17-33)30-39(44)27-37-32-49(41-24-14-5-15-25-41)46-43(37)35-20-10-3-11-21-35/h1-27,31-32H,28-30H2/b38-26+,39-27+ |
| InChIKey | AULDDCWBBUJKQU-FGGILOIWSA-N |
| XLogP | 8.94 |
| TPSA | 55.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.80 |
| LogP ≤ 5 | 8.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|