C12H23N2O5P — CID 155557826
(2S)-2-[[1-[[[(1R)-1-aminoethyl]-hydroxyphosphoryl]methyl]cyclopentanecarbonyl]amino]propanoic acid (PubChem CID 155557826) has the molecular formula C12H23N2O5P and a molecular weight of 306.30 g/mol. Its IUPAC name is (2S)-2-[[1-[[[(1R)-1-aminoethyl]-hydroxyphosphoryl]methyl]cyclopentanecarbonyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[1-[[[(1R)-1-aminoethyl]-hydroxyphosphoryl]methyl]cyclopentanecarbonyl]amino]propanoic acid |
|---|---|
| PubChem CID | 155557826 |
| Molecular Formula | C12H23N2O5P |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.13 |
| IUPAC Name | (2S)-2-[[1-[[[(1R)-1-aminoethyl]-hydroxyphosphoryl]methyl]cyclopentanecarbonyl]amino]propanoic acid |
| SMILES | C[C@H](NC(=O)C1(CP(=O)(O)[C@H](C)N)CCCC1)C(=O)O |
| InChI | InChI=1S/C12H23N2O5P/c1-8(10(15)16)14-11(17)12(5-3-4-6-12)7-20(18,19)9(2)13/h8-9H,3-7,13H2,1-2H3,(H,14,17)(H,15,16)(H,18,19)/t8-,9+/m0/s1 |
| InChIKey | JRVQUENGLRHHHG-DTWKUNHWSA-N |
| XLogP | 0.71 |
| TPSA | 129.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|