C26H24N4O6S — CID 155557911
2-(3,4-dimethoxyphenyl)-6-[1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]imidazo[1,2-a]pyridine (PubChem CID 155557911) has the molecular formula C26H24N4O6S and a molecular weight of 520.57 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-6-[1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]imidazo[1,2-a]pyridine.
| Compound Name | 2-(3,4-dimethoxyphenyl)-6-[1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]imidazo[1,2-a]pyridine |
|---|---|
| PubChem CID | 155557911 |
| Molecular Formula | C26H24N4O6S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-6-[1-(4-nitrophenyl)sulfonyl-3,6-dihydro-2H-pyridin-4-yl]imidazo[1,2-a]pyridine |
| SMILES | COc1ccc(-c2cn3cc(C4=CCN(S(=O)(=O)c5ccc([N+](=O)[O-])cc5)CC4)ccc3n2)cc1OC |
| InChI | InChI=1S/C26H24N4O6S/c1-35-24-9-3-19(15-25(24)36-2)23-17-28-16-20(4-10-26(28)27-23)18-11-13-29(14-12-18)37(33,34)22-7-5-21(6-8-22)30(31)32/h3-11,15-17H,12-14H2,1-2H3 |
| InChIKey | PXYHMFJZCLEHFB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|