C15H15N7O3S — CID 155557925
1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-phenylurea (PubChem CID 155557925) has the molecular formula C15H15N7O3S and a molecular weight of 373.40 g/mol. Its IUPAC name is 1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-phenylurea.
| Compound Name | 1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-phenylurea |
|---|---|
| PubChem CID | 155557925 |
| Molecular Formula | C15H15N7O3S |
| Molecular Weight | 373.40 g/mol |
| Exact Mass | 373.10 |
| IUPAC Name | 1-[5-amino-1-(4-sulfamoylphenyl)-1,2,4-triazol-3-yl]-3-phenylurea |
| SMILES | Nc1nc(NC(=O)Nc2ccccc2)nn1-c1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C15H15N7O3S/c16-13-19-14(20-15(23)18-10-4-2-1-3-5-10)21-22(13)11-6-8-12(9-7-11)26(17,24)25/h1-9H,(H2,17,24,25)(H4,16,18,19,20,21,23) |
| InChIKey | MDFYLPAPFMHRAH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 158.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.40 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |