About 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea
1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea (PubChem CID 155558153) has the molecular formula C22H17Cl2N3O2S
and a molecular weight of 458.37 g/mol. Its IUPAC name is 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea.
Molecular Properties
| Compound Name | 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea |
| PubChem CID | 155558153 |
| Molecular Formula | C22H17Cl2N3O2S |
| Molecular Weight | 458.37 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea |
| SMILES | Cc1cc(NC(=O)Nc2cc(Cl)cc(Cl)c2)ccc1OCc1nc2ccccc2s1 |
| InChI | InChI=1S/C22H17Cl2N3O2S/c1-13-8-16(25-22(28)26-17-10-14(23)9-15(24)11-17)6-7-19(13)29-12-21-27-18-4-2-3-5-20(18)30-21/h2-11H,12H2,1H3,(H2,25,26,28) |
| InChIKey | RFCWVWJZLAAPQL-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 458.37 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea?
The IUPAC name of 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea (CID 155558153) is 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea.
What is the SMILES notation for 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea?
The canonical SMILES for 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea is Cc1cc(NC(=O)Nc2cc(Cl)cc(Cl)c2)ccc1OCc1nc2ccccc2s1.
What is the InChIKey of 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea?
The InChIKey is RFCWVWJZLAAPQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17Cl2N3O2S/c1-13-8-16(25-22(28)26-17-10-14(23)9-15(24)11-17)6-7-19(13)29-12-21-27-18-4-2-3-5-20(18)30-21/h2-11H,12H2,1H3,(H2,25,26,28).
What are the key properties of 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea?
1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea has a molecular weight of 458.37 g/mol, XLogP of 7.13, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-(1,3-benzothiazol-2-ylmethoxy)-3-methylphenyl]-3-(3,5-dichlorophenyl)urea is sourced from PubChem (CID 155558153), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).