C20H20F2N4O2S — CID 155558154
tert-butyl 3-(2,4-difluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate (PubChem CID 155558154) has the molecular formula C20H20F2N4O2S and a molecular weight of 418.47 g/mol. Its IUPAC name is tert-butyl 3-(2,4-difluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate.
| Compound Name | tert-butyl 3-(2,4-difluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 155558154 |
| Molecular Formula | C20H20F2N4O2S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.13 |
| IUPAC Name | tert-butyl 3-(2,4-difluoroanilino)-8-thia-4,6,11-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6-tetraene-11-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2c(sc3ncnc(Nc4ccc(F)cc4F)c23)C1 |
| InChI | InChI=1S/C20H20F2N4O2S/c1-20(2,3)28-19(27)26-7-6-12-15(9-26)29-18-16(12)17(23-10-24-18)25-14-5-4-11(21)8-13(14)22/h4-5,8,10H,6-7,9H2,1-3H3,(H,23,24,25) |
| InChIKey | CPKVWABPQNYDQL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |