C19H19ClF3N3O3 — CID 155558328
(3R,5S)-5-[[(2E)-2-[[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid (PubChem CID 155558328) has the molecular formula C19H19ClF3N3O3 and a molecular weight of 429.83 g/mol. Its IUPAC name is (3R,5S)-5-[[(2E)-2-[[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid.
| Compound Name | (3R,5S)-5-[[(2E)-2-[[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 155558328 |
| Molecular Formula | C19H19ClF3N3O3 |
| Molecular Weight | 429.83 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (3R,5S)-5-[[(2E)-2-[[5-[2-chloro-4-(trifluoromethyl)phenyl]furan-2-yl]methylidene]hydrazinyl]methyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)[C@H]1CNC[C@@H](CN/N=C/c2ccc(-c3ccc(C(F)(F)F)cc3Cl)o2)C1 |
| InChI | InChI=1S/C19H19ClF3N3O3/c20-16-6-13(19(21,22)23)1-3-15(16)17-4-2-14(29-17)10-26-25-8-11-5-12(18(27)28)9-24-7-11/h1-4,6,10-12,24-25H,5,7-9H2,(H,27,28)/b26-10+/t11-,12+/m0/s1 |
| InChIKey | PRCWFMSJCHHGFE-ACLYYTTKSA-N |
| XLogP | 3.85 |
| TPSA | 86.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.83 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|