About 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid
3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid (PubChem CID 155558364) has the molecular formula C28H27Cl2N3O3
and a molecular weight of 524.45 g/mol. Its IUPAC name is 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid.
Molecular Properties
| Compound Name | 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid |
| PubChem CID | 155558364 |
| Molecular Formula | C28H27Cl2N3O3 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid |
| SMILES | CC(C)CC(c1ccc(C(=O)NCCC(=O)O)cc1)n1ncc2cc(-c3cc(Cl)cc(Cl)c3)ccc21 |
| InChI | InChI=1S/C28H27Cl2N3O3/c1-17(2)11-26(18-3-5-19(6-4-18)28(36)31-10-9-27(34)35)33-25-8-7-20(12-22(25)16-32-33)21-13-23(29)15-24(30)14-21/h3-8,12-17,26H,9-11H2,1-2H3,(H,31,36)(H,34,35) |
| InChIKey | BWEFDLLLWJITJK-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid?
The IUPAC name of 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid (CID 155558364) is 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid.
What is the SMILES notation for 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid?
The canonical SMILES for 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid is CC(C)CC(c1ccc(C(=O)NCCC(=O)O)cc1)n1ncc2cc(-c3cc(Cl)cc(Cl)c3)ccc21.
What is the InChIKey of 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid?
The InChIKey is BWEFDLLLWJITJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27Cl2N3O3/c1-17(2)11-26(18-3-5-19(6-4-18)28(36)31-10-9-27(34)35)33-25-8-7-20(12-22(25)16-32-33)21-13-23(29)15-24(30)14-21/h3-8,12-17,26H,9-11H2,1-2H3,(H,31,36)(H,34,35).
What are the key properties of 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid?
3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid has a molecular weight of 524.45 g/mol, XLogP of 6.85, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[4-[1-[5-(3,5-dichlorophenyl)indazol-1-yl]-3-methylbutyl]benzoyl]amino]propanoic acid is sourced from PubChem (CID 155558364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).