C19H21FO3 — CID 155558375
(6S,7aR)-7a-[1-(4-fluorophenyl)propan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one (PubChem CID 155558375) has the molecular formula C19H21FO3 and a molecular weight of 316.37 g/mol. Its IUPAC name is (6S,7aR)-7a-[1-(4-fluorophenyl)propan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one.
| Compound Name | (6S,7aR)-7a-[1-(4-fluorophenyl)propan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one |
|---|---|
| PubChem CID | 155558375 |
| Molecular Formula | C19H21FO3 |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.15 |
| IUPAC Name | (6S,7aR)-7a-[1-(4-fluorophenyl)propan-2-yl]-6-prop-2-enyl-6,7-dihydro-1,3-benzodioxol-5-one |
| SMILES | C=CC[C@H]1C[C@]2(C(C)Cc3ccc(F)cc3)OCOC2=CC1=O |
| InChI | InChI=1S/C19H21FO3/c1-3-4-15-11-19(18(10-17(15)21)22-12-23-19)13(2)9-14-5-7-16(20)8-6-14/h3,5-8,10,13,15H,1,4,9,11-12H2,2H3/t13?,15-,19+/m0/s1 |
| InChIKey | YBMNAYUTESYBFE-GSTZGWFYSA-N |
| XLogP | 3.80 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|