C26H18N4O2S3 — CID 155558627
(5Z)-3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-5-[(9-methylcarbazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 155558627) has the molecular formula C26H18N4O2S3 and a molecular weight of 514.66 g/mol. Its IUPAC name is (5Z)-3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-5-[(9-methylcarbazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-5-[(9-methylcarbazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 155558627 |
| Molecular Formula | C26H18N4O2S3 |
| Molecular Weight | 514.66 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | (5Z)-3-[5-(4-methoxyphenyl)-1,3,4-thiadiazol-2-yl]-5-[(9-methylcarbazol-3-yl)methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1ccc(-c2nnc(N3C(=O)/C(=C/c4ccc5c(c4)c4ccccc4n5C)SC3=S)s2)cc1 |
| InChI | InChI=1S/C26H18N4O2S3/c1-29-20-6-4-3-5-18(20)19-13-15(7-12-21(19)29)14-22-24(31)30(26(33)34-22)25-28-27-23(35-25)16-8-10-17(32-2)11-9-16/h3-14H,1-2H3/b22-14- |
| InChIKey | RGJYFHHWAIWDET-HMAPJEAMSA-N |
| XLogP | 6.26 |
| TPSA | 60.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.66 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|