C13H19N3O2 — CID 155558684
N-butyl-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-amine (PubChem CID 155558684) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is N-butyl-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-amine.
| Compound Name | N-butyl-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-amine |
|---|---|
| PubChem CID | 155558684 |
| Molecular Formula | C13H19N3O2 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | N-butyl-2,2-dimethyl-1,3-dioxidobenzimidazole-1,3-diium-5-amine |
| SMILES | CCCCNc1ccc2c(c1)=[N+]([O-])C(C)(C)[N+]=2[O-] |
| InChI | InChI=1S/C13H19N3O2/c1-4-5-8-14-10-6-7-11-12(9-10)16(18)13(2,3)15(11)17/h6-7,9,14H,4-5,8H2,1-3H3 |
| InChIKey | SSVMBHWTABXFRO-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 64.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|