C26H27F3N6O2S2 — CID 155558725
N-[3-[5-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide (PubChem CID 155558725) has the molecular formula C26H27F3N6O2S2 and a molecular weight of 576.67 g/mol. Its IUPAC name is N-[3-[5-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide.
| Compound Name | N-[3-[5-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
|---|---|
| PubChem CID | 155558725 |
| Molecular Formula | C26H27F3N6O2S2 |
| Molecular Weight | 576.67 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | N-[3-[5-[6-amino-5-(trifluoromethyl)-3-pyridinyl]-1,3-benzothiazol-2-yl]-4,5,6,7-tetrahydrothieno[2,3-c]pyridin-2-yl]-3-(2-methoxyethylamino)propanamide |
| SMILES | COCCNCCC(=O)Nc1sc2c(c1-c1nc3cc(-c4cnc(N)c(C(F)(F)F)c4)ccc3s1)CCNC2 |
| InChI | InChI=1S/C26H27F3N6O2S2/c1-37-9-8-31-7-5-21(36)35-25-22(16-4-6-32-13-20(16)39-25)24-34-18-11-14(2-3-19(18)38-24)15-10-17(26(27,28)29)23(30)33-12-15/h2-3,10-12,31-32H,4-9,13H2,1H3,(H2,30,33)(H,35,36) |
| InChIKey | RNZLSHFOUCJJDM-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.67 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|