About [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone
[3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone (PubChem CID 155558750) has the molecular formula C23H17NO4
and a molecular weight of 371.39 g/mol. Its IUPAC name is [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone.
Molecular Properties
| Compound Name | [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone |
| PubChem CID | 155558750 |
| Molecular Formula | C23H17NO4 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.12 |
| IUPAC Name | [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone |
| SMILES | O=C(c1ccc(O)cc1)n1cc(-c2ccc(O)cc2)c(-c2ccc(O)cc2)c1 |
| InChI | InChI=1S/C23H17NO4/c25-18-7-1-15(2-8-18)21-13-24(23(28)17-5-11-20(27)12-6-17)14-22(21)16-3-9-19(26)10-4-16/h1-14,25-27H |
| InChIKey | DSOYGABPHAOPRX-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 82.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone?
The IUPAC name of [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone (CID 155558750) is [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone.
What is the SMILES notation for [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone?
The canonical SMILES for [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone is O=C(c1ccc(O)cc1)n1cc(-c2ccc(O)cc2)c(-c2ccc(O)cc2)c1.
What is the InChIKey of [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone?
The InChIKey is DSOYGABPHAOPRX-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H17NO4/c25-18-7-1-15(2-8-18)21-13-24(23(28)17-5-11-20(27)12-6-17)14-22(21)16-3-9-19(26)10-4-16/h1-14,25-27H.
What are the key properties of [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone?
[3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone has a molecular weight of 371.39 g/mol, XLogP of 4.63, 3 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3,4-bis(4-hydroxyphenyl)pyrrol-1-yl]-(4-hydroxyphenyl)methanone is sourced from PubChem (CID 155558750), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).