C17H23ClN4 — CID 155558835
1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-(1H-imidazol-5-ylmethyl)methanamine (PubChem CID 155558835) has the molecular formula C17H23ClN4 and a molecular weight of 318.85 g/mol. Its IUPAC name is 1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-(1H-imidazol-5-ylmethyl)methanamine.
| Compound Name | 1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-(1H-imidazol-5-ylmethyl)methanamine |
|---|---|
| PubChem CID | 155558835 |
| Molecular Formula | C17H23ClN4 |
| Molecular Weight | 318.85 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | 1-[1-[(2-chlorophenyl)methyl]piperidin-4-yl]-N-(1H-imidazol-5-ylmethyl)methanamine |
| SMILES | Clc1ccccc1CN1CCC(CNCc2cnc[nH]2)CC1 |
| InChI | InChI=1S/C17H23ClN4/c18-17-4-2-1-3-15(17)12-22-7-5-14(6-8-22)9-19-10-16-11-20-13-21-16/h1-4,11,13-14,19H,5-10,12H2,(H,20,21) |
| InChIKey | LKJIPJRIGSWFNY-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.85 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |